C22H25N8O+ — CID 163979063
[2-[1-amino-3-(6-cyano-1H-benzimidazol-2-yl)-3-(5-methoxy-7-methyl-1H-indol-4-yl)propylidene]hydrazinyl]-methylazanium (PubChem CID 163979063) has the molecular formula C22H25N8O+ and a molecular weight of 417.50 g/mol. Its IUPAC name is [2-[1-amino-3-(6-cyano-1H-benzimidazol-2-yl)-3-(5-methoxy-7-methyl-1H-indol-4-yl)propylidene]hydrazinyl]-methylazanium.
| Compound Name | [2-[1-amino-3-(6-cyano-1H-benzimidazol-2-yl)-3-(5-methoxy-7-methyl-1H-indol-4-yl)propylidene]hydrazinyl]-methylazanium |
|---|---|
| PubChem CID | 163979063 |
| Molecular Formula | C22H25N8O+ |
| Molecular Weight | 417.50 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | [2-[1-amino-3-(6-cyano-1H-benzimidazol-2-yl)-3-(5-methoxy-7-methyl-1H-indol-4-yl)propylidene]hydrazinyl]-methylazanium |
| SMILES | C[NH2+]NN=C(N)CC(c1nc2ccc(C#N)cc2[nH]1)c1c(OC)cc(C)c2[nH]ccc12 |
| InChI | InChI=1S/C22H24N8O/c1-12-8-18(31-3)20(14-6-7-26-21(12)14)15(10-19(24)29-30-25-2)22-27-16-5-4-13(11-23)9-17(16)28-22/h4-9,15,25-26,30H,10H2,1-3H3,(H2,24,29)(H,27,28)/p+1 |
| InChIKey | SWTIQXBTZUIEKS-UHFFFAOYSA-O |
| XLogP | 1.72 |
| TPSA | 144.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.50 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|