C19H16N4O — CID 86701685
2-[[7-(hydroxymethyl)-5-methyl-1H-indol-4-yl]methyl]-3H-benzimidazole-5-carbonitrile (PubChem CID 86701685) has the molecular formula C19H16N4O and a molecular weight of 316.36 g/mol. Its IUPAC name is 2-[[7-(hydroxymethyl)-5-methyl-1H-indol-4-yl]methyl]-3H-benzimidazole-5-carbonitrile.
| Compound Name | 2-[[7-(hydroxymethyl)-5-methyl-1H-indol-4-yl]methyl]-3H-benzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 86701685 |
| Molecular Formula | C19H16N4O |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 2-[[7-(hydroxymethyl)-5-methyl-1H-indol-4-yl]methyl]-3H-benzimidazole-5-carbonitrile |
| SMILES | Cc1cc(CO)c2[nH]ccc2c1Cc1nc2ccc(C#N)cc2[nH]1 |
| InChI | InChI=1S/C19H16N4O/c1-11-6-13(10-24)19-14(4-5-21-19)15(11)8-18-22-16-3-2-12(9-20)7-17(16)23-18/h2-7,21,24H,8,10H2,1H3,(H,22,23) |
| InChIKey | HIGAIWMFFYEBBS-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |