C17H14ClN3 — CID 141393384
2-[(7-chloro-5-methyl-1H-indol-4-yl)methyl]-1H-benzimidazole (PubChem CID 141393384) has the molecular formula C17H14ClN3 and a molecular weight of 295.77 g/mol. Its IUPAC name is 2-[(7-chloro-5-methyl-1H-indol-4-yl)methyl]-1H-benzimidazole.
| Compound Name | 2-[(7-chloro-5-methyl-1H-indol-4-yl)methyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 141393384 |
| Molecular Formula | C17H14ClN3 |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 2-[(7-chloro-5-methyl-1H-indol-4-yl)methyl]-1H-benzimidazole |
| SMILES | Cc1cc(Cl)c2[nH]ccc2c1Cc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C17H14ClN3/c1-10-8-13(18)17-11(6-7-19-17)12(10)9-16-20-14-4-2-3-5-15(14)21-16/h2-8,19H,9H2,1H3,(H,20,21) |
| InChIKey | BQNRPQAQWQUJCG-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 44.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |