C16H16N2O2 — CID 139695649
2-[(2,6-dimethoxyphenyl)methyl]-1H-benzimidazole (PubChem CID 139695649) has the molecular formula C16H16N2O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is 2-[(2,6-dimethoxyphenyl)methyl]-1H-benzimidazole.
| Compound Name | 2-[(2,6-dimethoxyphenyl)methyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 139695649 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 2-[(2,6-dimethoxyphenyl)methyl]-1H-benzimidazole |
| SMILES | COc1cccc(OC)c1Cc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C16H16N2O2/c1-19-14-8-5-9-15(20-2)11(14)10-16-17-12-6-3-4-7-13(12)18-16/h3-9H,10H2,1-2H3,(H,17,18) |
| InChIKey | VTJMUVOYOFIDRU-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |