C19H19N3 — CID 141393452
2-[(5-ethyl-7-methyl-1H-indol-4-yl)methyl]-1H-benzimidazole (PubChem CID 141393452) has the molecular formula C19H19N3 and a molecular weight of 289.38 g/mol. Its IUPAC name is 2-[(5-ethyl-7-methyl-1H-indol-4-yl)methyl]-1H-benzimidazole.
| Compound Name | 2-[(5-ethyl-7-methyl-1H-indol-4-yl)methyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 141393452 |
| Molecular Formula | C19H19N3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 2-[(5-ethyl-7-methyl-1H-indol-4-yl)methyl]-1H-benzimidazole |
| SMILES | CCc1cc(C)c2[nH]ccc2c1Cc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C19H19N3/c1-3-13-10-12(2)19-14(8-9-20-19)15(13)11-18-21-16-6-4-5-7-17(16)22-18/h4-10,20H,3,11H2,1-2H3,(H,21,22) |
| InChIKey | WSBBHBOPQKMVAN-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 44.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |