C33H39N5O5S2Si — CID 86701639
N-[[6-cyano-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]-[5,7-dimethyl-1-(4-methylphenyl)sulfonylindol-4-yl]methyl]methanesulfonamide (PubChem CID 86701639) has the molecular formula C33H39N5O5S2Si and a molecular weight of 677.93 g/mol. Its IUPAC name is N-[[6-cyano-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]-[5,7-dimethyl-1-(4-methylphenyl)sulfonylindol-4-yl]methyl]methanesulfonamide.
| Compound Name | N-[[6-cyano-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]-[5,7-dimethyl-1-(4-methylphenyl)sulfonylindol-4-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 86701639 |
| Molecular Formula | C33H39N5O5S2Si |
| Molecular Weight | 677.93 g/mol |
| Exact Mass | 677.22 |
| IUPAC Name | N-[[6-cyano-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]-[5,7-dimethyl-1-(4-methylphenyl)sulfonylindol-4-yl]methyl]methanesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3c(C(NS(C)(=O)=O)c4nc5ccc(C#N)cc5n4COCC[Si](C)(C)C)c(C)cc(C)c32)cc1 |
| InChI | InChI=1S/C33H39N5O5S2Si/c1-22-8-11-26(12-9-22)45(41,42)38-15-14-27-30(23(2)18-24(3)32(27)38)31(36-44(4,39)40)33-35-28-13-10-25(20-34)19-29(28)37(33)21-43-16-17-46(5,6)7/h8-15,18-19,31,36H,16-17,21H2,1-7H3 |
| InChIKey | NUMSQLOKFNAQPE-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 136.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.93 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|