C34H40N4O6S2Si — CID 86701461
2-[1-methoxy-1-[7-methyl-1-(4-methylphenyl)sulfonyl-5-methylsulfonylindol-4-yl]ethyl]-3-(2-trimethylsilylethoxymethyl)benzimidazole-5-carbonitrile (PubChem CID 86701461) has the molecular formula C34H40N4O6S2Si and a molecular weight of 692.94 g/mol. Its IUPAC name is 2-[1-methoxy-1-[7-methyl-1-(4-methylphenyl)sulfonyl-5-methylsulfonylindol-4-yl]ethyl]-3-(2-trimethylsilylethoxymethyl)benzimidazole-5-carbonitrile.
| Compound Name | 2-[1-methoxy-1-[7-methyl-1-(4-methylphenyl)sulfonyl-5-methylsulfonylindol-4-yl]ethyl]-3-(2-trimethylsilylethoxymethyl)benzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 86701461 |
| Molecular Formula | C34H40N4O6S2Si |
| Molecular Weight | 692.94 g/mol |
| Exact Mass | 692.22 |
| IUPAC Name | 2-[1-methoxy-1-[7-methyl-1-(4-methylphenyl)sulfonyl-5-methylsulfonylindol-4-yl]ethyl]-3-(2-trimethylsilylethoxymethyl)benzimidazole-5-carbonitrile |
| SMILES | COC(C)(c1c(S(C)(=O)=O)cc(C)c2c1ccn2S(=O)(=O)c1ccc(C)cc1)c1nc2ccc(C#N)cc2n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C34H40N4O6S2Si/c1-23-9-12-26(13-10-23)46(41,42)38-16-15-27-31(30(45(5,39)40)19-24(2)32(27)38)34(3,43-4)33-36-28-14-11-25(21-35)20-29(28)37(33)22-44-17-18-47(6,7)8/h9-16,19-20H,17-18,22H2,1-8H3 |
| InChIKey | UZVGKGKWADUTCF-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 133.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.94 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|