C32H36N4O4SSi — CID 86701556
2-[[7-methyl-1-(4-methylphenyl)sulfonyl-5-(2-trimethylsilylethoxymethoxymethyl)indol-4-yl]methyl]-3H-benzimidazole-5-carbonitrile (PubChem CID 86701556) has the molecular formula C32H36N4O4SSi and a molecular weight of 600.82 g/mol. Its IUPAC name is 2-[[7-methyl-1-(4-methylphenyl)sulfonyl-5-(2-trimethylsilylethoxymethoxymethyl)indol-4-yl]methyl]-3H-benzimidazole-5-carbonitrile.
| Compound Name | 2-[[7-methyl-1-(4-methylphenyl)sulfonyl-5-(2-trimethylsilylethoxymethoxymethyl)indol-4-yl]methyl]-3H-benzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 86701556 |
| Molecular Formula | C32H36N4O4SSi |
| Molecular Weight | 600.82 g/mol |
| Exact Mass | 600.22 |
| IUPAC Name | 2-[[7-methyl-1-(4-methylphenyl)sulfonyl-5-(2-trimethylsilylethoxymethoxymethyl)indol-4-yl]methyl]-3H-benzimidazole-5-carbonitrile |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3c(Cc4nc5ccc(C#N)cc5[nH]4)c(COCOCC[Si](C)(C)C)cc(C)c32)cc1 |
| InChI | InChI=1S/C32H36N4O4SSi/c1-22-6-9-26(10-7-22)41(37,38)36-13-12-27-28(18-31-34-29-11-8-24(19-33)17-30(29)35-31)25(16-23(2)32(27)36)20-40-21-39-14-15-42(3,4)5/h6-13,16-17H,14-15,18,20-21H2,1-5H3,(H,34,35) |
| InChIKey | JDWMUEGIGSELOF-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.82 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|