C32H34N4O4SSi — CID 86701612
2-[5,7-dimethyl-1-(4-methylphenyl)sulfonylindole-4-carbonyl]-3-(2-trimethylsilylethoxymethyl)benzimidazole-5-carbonitrile (PubChem CID 86701612) has the molecular formula C32H34N4O4SSi and a molecular weight of 598.80 g/mol. Its IUPAC name is 2-[5,7-dimethyl-1-(4-methylphenyl)sulfonylindole-4-carbonyl]-3-(2-trimethylsilylethoxymethyl)benzimidazole-5-carbonitrile.
| Compound Name | 2-[5,7-dimethyl-1-(4-methylphenyl)sulfonylindole-4-carbonyl]-3-(2-trimethylsilylethoxymethyl)benzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 86701612 |
| Molecular Formula | C32H34N4O4SSi |
| Molecular Weight | 598.80 g/mol |
| Exact Mass | 598.21 |
| IUPAC Name | 2-[5,7-dimethyl-1-(4-methylphenyl)sulfonylindole-4-carbonyl]-3-(2-trimethylsilylethoxymethyl)benzimidazole-5-carbonitrile |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3c(C(=O)c4nc5ccc(C#N)cc5n4COCC[Si](C)(C)C)c(C)cc(C)c32)cc1 |
| InChI | InChI=1S/C32H34N4O4SSi/c1-21-7-10-25(11-8-21)41(38,39)36-14-13-26-29(22(2)17-23(3)30(26)36)31(37)32-34-27-12-9-24(19-33)18-28(27)35(32)20-40-15-16-42(4,5)6/h7-14,17-18H,15-16,20H2,1-6H3 |
| InChIKey | RWAYZKFVIAZJET-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 106.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.80 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|