C33H38N4O3SSi — CID 141457430
2-[[1-(1,3-dimethylcyclohexa-2,4-dien-1-yl)sulfonyl-7-ethenylindol-4-yl]methyl]-3-(2-trimethylsilylethoxymethyl)benzimidazole-5-carbonitrile (PubChem CID 141457430) has the molecular formula C33H38N4O3SSi and a molecular weight of 598.85 g/mol. Its IUPAC name is 2-[[1-(1,3-dimethylcyclohexa-2,4-dien-1-yl)sulfonyl-7-ethenylindol-4-yl]methyl]-3-(2-trimethylsilylethoxymethyl)benzimidazole-5-carbonitrile.
| Compound Name | 2-[[1-(1,3-dimethylcyclohexa-2,4-dien-1-yl)sulfonyl-7-ethenylindol-4-yl]methyl]-3-(2-trimethylsilylethoxymethyl)benzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 141457430 |
| Molecular Formula | C33H38N4O3SSi |
| Molecular Weight | 598.85 g/mol |
| Exact Mass | 598.24 |
| IUPAC Name | 2-[[1-(1,3-dimethylcyclohexa-2,4-dien-1-yl)sulfonyl-7-ethenylindol-4-yl]methyl]-3-(2-trimethylsilylethoxymethyl)benzimidazole-5-carbonitrile |
| SMILES | C=Cc1ccc(Cc2nc3ccc(C#N)cc3n2COCC[Si](C)(C)C)c2ccn(S(=O)(=O)C3(C)C=C(C)C=CC3)c12 |
| InChI | InChI=1S/C33H38N4O3SSi/c1-7-26-11-12-27(28-14-16-37(32(26)28)41(38,39)33(3)15-8-9-24(2)21-33)20-31-35-29-13-10-25(22-34)19-30(29)36(31)23-40-17-18-42(4,5)6/h7-14,16,19,21H,1,15,17-18,20,23H2,2-6H3 |
| InChIKey | GMSWJBDUYUAGHL-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 89.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.85 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|