C32H36N4O4SSi — CID 141457360
2-[1-(1,3-dimethylcyclohexa-2,4-dien-1-yl)sulfonyl-7-methylindole-4-carbonyl]-1-(2-trimethylsilylethoxymethyl)benzimidazole-5-carbonitrile (PubChem CID 141457360) has the molecular formula C32H36N4O4SSi and a molecular weight of 600.82 g/mol. Its IUPAC name is 2-[1-(1,3-dimethylcyclohexa-2,4-dien-1-yl)sulfonyl-7-methylindole-4-carbonyl]-1-(2-trimethylsilylethoxymethyl)benzimidazole-5-carbonitrile.
| Compound Name | 2-[1-(1,3-dimethylcyclohexa-2,4-dien-1-yl)sulfonyl-7-methylindole-4-carbonyl]-1-(2-trimethylsilylethoxymethyl)benzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 141457360 |
| Molecular Formula | C32H36N4O4SSi |
| Molecular Weight | 600.82 g/mol |
| Exact Mass | 600.22 |
| IUPAC Name | 2-[1-(1,3-dimethylcyclohexa-2,4-dien-1-yl)sulfonyl-7-methylindole-4-carbonyl]-1-(2-trimethylsilylethoxymethyl)benzimidazole-5-carbonitrile |
| SMILES | CC1=CC(C)(S(=O)(=O)n2ccc3c(C(=O)c4nc5cc(C#N)ccc5n4COCC[Si](C)(C)C)ccc(C)c32)CC=C1 |
| InChI | InChI=1S/C32H36N4O4SSi/c1-22-8-7-14-32(3,19-22)41(38,39)36-15-13-25-26(11-9-23(2)29(25)36)30(37)31-34-27-18-24(20-33)10-12-28(27)35(31)21-40-16-17-42(4,5)6/h7-13,15,18-19H,14,16-17,21H2,1-6H3 |
| InChIKey | CYVXWXWXPJLFBK-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 106.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.82 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|