C36H52N4O5Si2 — CID 86701776
methyl 4-[5-cyano-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]-4-[5-methoxy-7-methyl-1-(2-trimethylsilylethoxymethyl)indol-4-yl]pentanoate (PubChem CID 86701776) has the molecular formula C36H52N4O5Si2 and a molecular weight of 677.01 g/mol. Its IUPAC name is methyl 4-[5-cyano-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]-4-[5-methoxy-7-methyl-1-(2-trimethylsilylethoxymethyl)indol-4-yl]pentanoate.
| Compound Name | methyl 4-[5-cyano-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]-4-[5-methoxy-7-methyl-1-(2-trimethylsilylethoxymethyl)indol-4-yl]pentanoate |
|---|---|
| PubChem CID | 86701776 |
| Molecular Formula | C36H52N4O5Si2 |
| Molecular Weight | 677.01 g/mol |
| Exact Mass | 676.35 |
| IUPAC Name | methyl 4-[5-cyano-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]-4-[5-methoxy-7-methyl-1-(2-trimethylsilylethoxymethyl)indol-4-yl]pentanoate |
| SMILES | COC(=O)CCC(C)(c1c(OC)cc(C)c2c1ccn2COCC[Si](C)(C)C)c1nc2cc(C#N)ccc2n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C36H52N4O5Si2/c1-26-21-31(42-3)33(28-14-16-39(34(26)28)24-44-17-19-46(5,6)7)36(2,15-13-32(41)43-4)35-38-29-22-27(23-37)11-12-30(29)40(35)25-45-18-20-47(8,9)10/h11-12,14,16,21-22H,13,15,17-20,24-25H2,1-10H3 |
| InChIKey | LXKRVYYGOVFITA-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 100.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.01 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|