C31H40N4O5Si — CID 86701489
tert-butyl 4-[1-[6-cyano-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]-1-hydroxyethyl]-5-methoxy-7-methylindole-1-carboxylate (PubChem CID 86701489) has the molecular formula C31H40N4O5Si and a molecular weight of 576.77 g/mol. Its IUPAC name is tert-butyl 4-[1-[6-cyano-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]-1-hydroxyethyl]-5-methoxy-7-methylindole-1-carboxylate.
| Compound Name | tert-butyl 4-[1-[6-cyano-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]-1-hydroxyethyl]-5-methoxy-7-methylindole-1-carboxylate |
|---|---|
| PubChem CID | 86701489 |
| Molecular Formula | C31H40N4O5Si |
| Molecular Weight | 576.77 g/mol |
| Exact Mass | 576.28 |
| IUPAC Name | tert-butyl 4-[1-[6-cyano-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]-1-hydroxyethyl]-5-methoxy-7-methylindole-1-carboxylate |
| SMILES | COc1cc(C)c2c(ccn2C(=O)OC(C)(C)C)c1C(C)(O)c1nc2ccc(C#N)cc2n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C31H40N4O5Si/c1-20-16-25(38-6)26(22-12-13-34(27(20)22)29(36)40-30(2,3)4)31(5,37)28-33-23-11-10-21(18-32)17-24(23)35(28)19-39-14-15-41(7,8)9/h10-13,16-17,37H,14-15,19H2,1-9H3 |
| InChIKey | CIYJBORBRYBFHB-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 111.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.77 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|