C35H47N4O6Si+ — CID 140620331
tert-butyl 4-[1-[5-cyano-3-(2-trimethylsilylethoxymethyl)-1H-benzimidazol-3-ium-2-yl]-4-methoxy-3-methyl-4-oxobutyl]-5-methoxy-7-methylindole-1-carboxylate (PubChem CID 140620331) has the molecular formula C35H47N4O6Si+ and a molecular weight of 647.87 g/mol. Its IUPAC name is tert-butyl 4-[1-[5-cyano-3-(2-trimethylsilylethoxymethyl)-1H-benzimidazol-3-ium-2-yl]-4-methoxy-3-methyl-4-oxobutyl]-5-methoxy-7-methylindole-1-carboxylate.
| Compound Name | tert-butyl 4-[1-[5-cyano-3-(2-trimethylsilylethoxymethyl)-1H-benzimidazol-3-ium-2-yl]-4-methoxy-3-methyl-4-oxobutyl]-5-methoxy-7-methylindole-1-carboxylate |
|---|---|
| PubChem CID | 140620331 |
| Molecular Formula | C35H47N4O6Si+ |
| Molecular Weight | 647.87 g/mol |
| Exact Mass | 647.33 |
| IUPAC Name | tert-butyl 4-[1-[5-cyano-3-(2-trimethylsilylethoxymethyl)-1H-benzimidazol-3-ium-2-yl]-4-methoxy-3-methyl-4-oxobutyl]-5-methoxy-7-methylindole-1-carboxylate |
| SMILES | COC(=O)C(C)CC(c1c(OC)cc(C)c2c1ccn2C(=O)OC(C)(C)C)c1[nH]c2ccc(C#N)cc2[n+]1COCC[Si](C)(C)C |
| InChI | InChI=1S/C35H46N4O6Si/c1-22-18-29(42-6)30(25-13-14-38(31(22)25)34(41)45-35(3,4)5)26(17-23(2)33(40)43-7)32-37-27-12-11-24(20-36)19-28(27)39(32)21-44-15-16-46(8,9)10/h11-14,18-19,23,26H,15-17,21H2,1-10H3/p+1 |
| InChIKey | DAYTZPULGBECKY-UHFFFAOYSA-O |
| XLogP | 7.03 |
| TPSA | 119.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.87 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|