C30H36F2N4O5Si — CID 86701445
tert-butyl 4-[[6-cyano-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]-hydroxymethyl]-5-(difluoromethoxy)-7-methylindole-1-carboxylate (PubChem CID 86701445) has the molecular formula C30H36F2N4O5Si and a molecular weight of 598.72 g/mol. Its IUPAC name is tert-butyl 4-[[6-cyano-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]-hydroxymethyl]-5-(difluoromethoxy)-7-methylindole-1-carboxylate.
| Compound Name | tert-butyl 4-[[6-cyano-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]-hydroxymethyl]-5-(difluoromethoxy)-7-methylindole-1-carboxylate |
|---|---|
| PubChem CID | 86701445 |
| Molecular Formula | C30H36F2N4O5Si |
| Molecular Weight | 598.72 g/mol |
| Exact Mass | 598.24 |
| IUPAC Name | tert-butyl 4-[[6-cyano-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]-hydroxymethyl]-5-(difluoromethoxy)-7-methylindole-1-carboxylate |
| SMILES | Cc1cc(OC(F)F)c(C(O)c2nc3ccc(C#N)cc3n2COCC[Si](C)(C)C)c2ccn(C(=O)OC(C)(C)C)c12 |
| InChI | InChI=1S/C30H36F2N4O5Si/c1-18-14-23(40-28(31)32)24(20-10-11-35(25(18)20)29(38)41-30(2,3)4)26(37)27-34-21-9-8-19(16-33)15-22(21)36(27)17-39-12-13-42(5,6)7/h8-11,14-15,26,28,37H,12-13,17H2,1-7H3 |
| InChIKey | PCVSZLOADXEORK-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 111.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.72 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|