C29H40N6O3Si — CID 171839783
tert-butyl 4-[[5-cyano-4-[1-(2-trimethylsilylethoxymethyl)indazol-4-yl]-2-pyridinyl]amino]piperidine-1-carboxylate (PubChem CID 171839783) has the molecular formula C29H40N6O3Si and a molecular weight of 548.76 g/mol. Its IUPAC name is tert-butyl 4-[[5-cyano-4-[1-(2-trimethylsilylethoxymethyl)indazol-4-yl]-2-pyridinyl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[5-cyano-4-[1-(2-trimethylsilylethoxymethyl)indazol-4-yl]-2-pyridinyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 171839783 |
| Molecular Formula | C29H40N6O3Si |
| Molecular Weight | 548.76 g/mol |
| Exact Mass | 548.29 |
| IUPAC Name | tert-butyl 4-[[5-cyano-4-[1-(2-trimethylsilylethoxymethyl)indazol-4-yl]-2-pyridinyl]amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Nc2cc(-c3cccc4c3cnn4COCC[Si](C)(C)C)c(C#N)cn2)CC1 |
| InChI | InChI=1S/C29H40N6O3Si/c1-29(2,3)38-28(36)34-12-10-22(11-13-34)33-27-16-24(21(17-30)18-31-27)23-8-7-9-26-25(23)19-32-35(26)20-37-14-15-39(4,5)6/h7-9,16,18-19,22H,10-15,20H2,1-6H3,(H,31,33) |
| InChIKey | AUOYVGCMGAXDLM-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 105.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.76 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|