C33H49N3O4Si — CID 164881108
tert-butyl 4-[hydroxy-[5-(2-propan-2-ylphenyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-c]pyridin-3-yl]methyl]piperidine-1-carboxylate (PubChem CID 164881108) has the molecular formula C33H49N3O4Si and a molecular weight of 579.86 g/mol. Its IUPAC name is tert-butyl 4-[hydroxy-[5-(2-propan-2-ylphenyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-c]pyridin-3-yl]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[hydroxy-[5-(2-propan-2-ylphenyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-c]pyridin-3-yl]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 164881108 |
| Molecular Formula | C33H49N3O4Si |
| Molecular Weight | 579.86 g/mol |
| Exact Mass | 579.35 |
| IUPAC Name | tert-butyl 4-[hydroxy-[5-(2-propan-2-ylphenyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-c]pyridin-3-yl]methyl]piperidine-1-carboxylate |
| SMILES | CC(C)c1ccccc1-c1cc2c(C(O)C3CCN(C(=O)OC(C)(C)C)CC3)cn(COCC[Si](C)(C)C)c2cn1 |
| InChI | InChI=1S/C33H49N3O4Si/c1-23(2)25-11-9-10-12-26(25)29-19-27-28(21-36(30(27)20-34-29)22-39-17-18-41(6,7)8)31(37)24-13-15-35(16-14-24)32(38)40-33(3,4)5/h9-12,19-21,23-24,31,37H,13-18,22H2,1-8H3 |
| InChIKey | JXNGLYKGKJISPH-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.86 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|