C34H45BN2O4Si — CID 164881202
trimethyl-[2-[[5-(2-propan-2-ylphenyl)-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]pyrrolo[2,3-c]pyridin-1-yl]methoxy]ethyl]silane (PubChem CID 164881202) has the molecular formula C34H45BN2O4Si and a molecular weight of 584.64 g/mol. Its IUPAC name is trimethyl-[2-[[5-(2-propan-2-ylphenyl)-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]pyrrolo[2,3-c]pyridin-1-yl]methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[[5-(2-propan-2-ylphenyl)-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]pyrrolo[2,3-c]pyridin-1-yl]methoxy]ethyl]silane |
|---|---|
| PubChem CID | 164881202 |
| Molecular Formula | C34H45BN2O4Si |
| Molecular Weight | 584.64 g/mol |
| Exact Mass | 584.32 |
| IUPAC Name | trimethyl-[2-[[5-(2-propan-2-ylphenyl)-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]pyrrolo[2,3-c]pyridin-1-yl]methoxy]ethyl]silane |
| SMILES | CC(C)c1ccccc1-c1cc2c(Oc3ccc(B4OC(C)(C)C(C)(C)O4)cc3)cn(COCC[Si](C)(C)C)c2cn1 |
| InChI | InChI=1S/C34H45BN2O4Si/c1-24(2)27-12-10-11-13-28(27)30-20-29-31(21-36-30)37(23-38-18-19-42(7,8)9)22-32(29)39-26-16-14-25(15-17-26)35-40-33(3,4)34(5,6)41-35/h10-17,20-22,24H,18-19,23H2,1-9H3 |
| InChIKey | UQPPDOLOJXQRDH-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 54.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.64 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|