C23H32N4O3Si — CID 174009702
2-[5-[(1-methylazetidin-3-yl)methoxy]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-c]pyridazin-3-yl]phenol (PubChem CID 174009702) has the molecular formula C23H32N4O3Si and a molecular weight of 440.62 g/mol. Its IUPAC name is 2-[5-[(1-methylazetidin-3-yl)methoxy]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-c]pyridazin-3-yl]phenol.
| Compound Name | 2-[5-[(1-methylazetidin-3-yl)methoxy]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-c]pyridazin-3-yl]phenol |
|---|---|
| PubChem CID | 174009702 |
| Molecular Formula | C23H32N4O3Si |
| Molecular Weight | 440.62 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | 2-[5-[(1-methylazetidin-3-yl)methoxy]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-c]pyridazin-3-yl]phenol |
| SMILES | CN1CC(COc2cn(COCC[Si](C)(C)C)c3nnc(-c4ccccc4O)cc23)C1 |
| InChI | InChI=1S/C23H32N4O3Si/c1-26-12-17(13-26)15-30-22-14-27(16-29-9-10-31(2,3)4)23-19(22)11-20(24-25-23)18-7-5-6-8-21(18)28/h5-8,11,14,17,28H,9-10,12-13,15-16H2,1-4H3 |
| InChIKey | DDTNHTVSCXKZEF-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 72.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.62 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|