C24H30FN3O3Si — CID 163252137
cis-(1R,2R)-2-fluoro-N-[3-(2-methoxyphenyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-6-yl]cyclopropane-1-carboxamide (PubChem CID 163252137) has the molecular formula C24H30FN3O3Si and a molecular weight of 455.61 g/mol. Its IUPAC name is cis-(1R,2R)-2-fluoro-N-[3-(2-methoxyphenyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-6-yl]cyclopropane-1-carboxamide.
| Compound Name | cis-(1R,2R)-2-fluoro-N-[3-(2-methoxyphenyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-6-yl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 163252137 |
| Molecular Formula | C24H30FN3O3Si |
| Molecular Weight | 455.61 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | cis-(1R,2R)-2-fluoro-N-[3-(2-methoxyphenyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-6-yl]cyclopropane-1-carboxamide |
| SMILES | COc1ccccc1-c1cn(COCC[Si](C)(C)C)c2nc(NC(=O)[C@H]3C[C@H]3F)ccc12 |
| InChI | InChI=1S/C24H30FN3O3Si/c1-30-21-8-6-5-7-16(21)19-14-28(15-31-11-12-32(2,3)4)23-17(19)9-10-22(26-23)27-24(29)18-13-20(18)25/h5-10,14,18,20H,11-13,15H2,1-4H3,(H,26,27,29)/t18-,20+/m0/s1 |
| InChIKey | YRZXOKHZHGYHSN-AZUAARDMSA-N |
| XLogP | 5.32 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.61 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|