C28H36N4O5Si — CID 163251103
cis-(1R,2R)-N-[3-(4-cyclobutyloxy-2-methoxy-3-pyridinyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-6-yl]-2-formylcyclopropane-1-carboxamide (PubChem CID 163251103) has the molecular formula C28H36N4O5Si and a molecular weight of 536.71 g/mol. Its IUPAC name is cis-(1R,2R)-N-[3-(4-cyclobutyloxy-2-methoxy-3-pyridinyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-6-yl]-2-formylcyclopropane-1-carboxamide.
| Compound Name | cis-(1R,2R)-N-[3-(4-cyclobutyloxy-2-methoxy-3-pyridinyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-6-yl]-2-formylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 163251103 |
| Molecular Formula | C28H36N4O5Si |
| Molecular Weight | 536.71 g/mol |
| Exact Mass | 536.25 |
| IUPAC Name | cis-(1R,2R)-N-[3-(4-cyclobutyloxy-2-methoxy-3-pyridinyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-6-yl]-2-formylcyclopropane-1-carboxamide |
| SMILES | COc1nccc(OC2CCC2)c1-c1cn(COCC[Si](C)(C)C)c2nc(NC(=O)[C@@H]3C[C@H]3C=O)ccc12 |
| InChI | InChI=1S/C28H36N4O5Si/c1-35-28-25(23(10-11-29-28)37-19-6-5-7-19)22-15-32(17-36-12-13-38(2,3)4)26-20(22)8-9-24(30-26)31-27(34)21-14-18(21)16-33/h8-11,15-16,18-19,21H,5-7,12-14,17H2,1-4H3,(H,30,31,34)/t18-,21+/m0/s1 |
| InChIKey | PYWHRXAFSIAXMZ-GHTZIAJQSA-N |
| XLogP | 5.12 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.71 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|