C26H31F2N3O3Si — CID 170688462
N-[3-(2-cyclopropyloxy-6-fluorophenyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-6-yl]-2-fluorocyclopropane-1-carboxamide (PubChem CID 170688462) has the molecular formula C26H31F2N3O3Si and a molecular weight of 499.63 g/mol. Its IUPAC name is N-[3-(2-cyclopropyloxy-6-fluorophenyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-6-yl]-2-fluorocyclopropane-1-carboxamide.
| Compound Name | N-[3-(2-cyclopropyloxy-6-fluorophenyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-6-yl]-2-fluorocyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 170688462 |
| Molecular Formula | C26H31F2N3O3Si |
| Molecular Weight | 499.63 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | N-[3-(2-cyclopropyloxy-6-fluorophenyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-6-yl]-2-fluorocyclopropane-1-carboxamide |
| SMILES | C[Si](C)(C)CCOCn1cc(-c2c(F)cccc2OC2CC2)c2ccc(NC(=O)C3CC3F)nc21 |
| InChI | InChI=1S/C26H31F2N3O3Si/c1-35(2,3)12-11-33-15-31-14-19(24-20(27)5-4-6-22(24)34-16-7-8-16)17-9-10-23(29-25(17)31)30-26(32)18-13-21(18)28/h4-6,9-10,14,16,18,21H,7-8,11-13,15H2,1-3H3,(H,29,30,32) |
| InChIKey | LUWHCHMNIYTALY-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.63 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|