C24H31N3O2Si — CID 163251034
N-[3-(2-methylphenyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-6-yl]cyclopropanecarboxamide (PubChem CID 163251034) has the molecular formula C24H31N3O2Si and a molecular weight of 421.62 g/mol. Its IUPAC name is N-[3-(2-methylphenyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-6-yl]cyclopropanecarboxamide.
| Compound Name | N-[3-(2-methylphenyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-6-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 163251034 |
| Molecular Formula | C24H31N3O2Si |
| Molecular Weight | 421.62 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | N-[3-(2-methylphenyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-6-yl]cyclopropanecarboxamide |
| SMILES | Cc1ccccc1-c1cn(COCC[Si](C)(C)C)c2nc(NC(=O)C3CC3)ccc12 |
| InChI | InChI=1S/C24H31N3O2Si/c1-17-7-5-6-8-19(17)21-15-27(16-29-13-14-30(2,3)4)23-20(21)11-12-22(25-23)26-24(28)18-9-10-18/h5-8,11-12,15,18H,9-10,13-14,16H2,1-4H3,(H,25,26,28) |
| InChIKey | OAMBAADGWDPOFE-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.62 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|