C28H39N5O4Si — CID 163251656
tert-butyl N-[3-[6-(cyclopropanecarbonylamino)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]-2-pyridinyl]-N-methylcarbamate (PubChem CID 163251656) has the molecular formula C28H39N5O4Si and a molecular weight of 537.74 g/mol. Its IUPAC name is tert-butyl N-[3-[6-(cyclopropanecarbonylamino)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]-2-pyridinyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[3-[6-(cyclopropanecarbonylamino)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]-2-pyridinyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 163251656 |
| Molecular Formula | C28H39N5O4Si |
| Molecular Weight | 537.74 g/mol |
| Exact Mass | 537.28 |
| IUPAC Name | tert-butyl N-[3-[6-(cyclopropanecarbonylamino)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]-2-pyridinyl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)c1ncccc1-c1cn(COCC[Si](C)(C)C)c2nc(NC(=O)C3CC3)ccc12 |
| InChI | InChI=1S/C28H39N5O4Si/c1-28(2,3)37-27(35)32(4)24-20(9-8-14-29-24)22-17-33(18-36-15-16-38(5,6)7)25-21(22)12-13-23(30-25)31-26(34)19-10-11-19/h8-9,12-14,17,19H,10-11,15-16,18H2,1-7H3,(H,30,31,34) |
| InChIKey | LFUJFHXPOBDFED-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.74 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|