C26H34N4O4SSi — CID 163251197
tert-butyl N-[3-(5-methoxy-1,3-benzothiazol-6-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-6-yl]carbamate (PubChem CID 163251197) has the molecular formula C26H34N4O4SSi and a molecular weight of 526.74 g/mol. Its IUPAC name is tert-butyl N-[3-(5-methoxy-1,3-benzothiazol-6-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-6-yl]carbamate.
| Compound Name | tert-butyl N-[3-(5-methoxy-1,3-benzothiazol-6-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-6-yl]carbamate |
|---|---|
| PubChem CID | 163251197 |
| Molecular Formula | C26H34N4O4SSi |
| Molecular Weight | 526.74 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | tert-butyl N-[3-(5-methoxy-1,3-benzothiazol-6-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-6-yl]carbamate |
| SMILES | COc1cc2ncsc2cc1-c1cn(COCC[Si](C)(C)C)c2nc(NC(=O)OC(C)(C)C)ccc12 |
| InChI | InChI=1S/C26H34N4O4SSi/c1-26(2,3)34-25(31)29-23-9-8-17-19(18-12-22-20(27-15-35-22)13-21(18)32-4)14-30(24(17)28-23)16-33-10-11-36(5,6)7/h8-9,12-15H,10-11,16H2,1-7H3,(H,28,29,31) |
| InChIKey | VEIXVUZNJIBLDT-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.74 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|