C20H24ClN5O2Si — CID 163251444
2-[[6-chloro-3-(7-methoxy-[1,2,4]triazolo[4,3-a]pyridin-6-yl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 163251444) has the molecular formula C20H24ClN5O2Si and a molecular weight of 429.98 g/mol. Its IUPAC name is 2-[[6-chloro-3-(7-methoxy-[1,2,4]triazolo[4,3-a]pyridin-6-yl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[6-chloro-3-(7-methoxy-[1,2,4]triazolo[4,3-a]pyridin-6-yl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 163251444 |
| Molecular Formula | C20H24ClN5O2Si |
| Molecular Weight | 429.98 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | 2-[[6-chloro-3-(7-methoxy-[1,2,4]triazolo[4,3-a]pyridin-6-yl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | COc1cc2nncn2cc1-c1cn(COCC[Si](C)(C)C)c2nc(Cl)ccc12 |
| InChI | InChI=1S/C20H24ClN5O2Si/c1-27-17-9-19-24-22-12-25(19)11-16(17)15-10-26(13-28-7-8-29(2,3)4)20-14(15)5-6-18(21)23-20/h5-6,9-12H,7-8,13H2,1-4H3 |
| InChIKey | WXCLGROSEXIDAS-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 66.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.98 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|