C19H24ClN3O2Si — CID 163251763
2-[[6-chloro-3-[2-(trideuteriomethoxy)phenyl]pyrazolo[5,4-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 163251763) has the molecular formula C19H24ClN3O2Si and a molecular weight of 392.98 g/mol. Its IUPAC name is 2-[[6-chloro-3-[2-(trideuteriomethoxy)phenyl]pyrazolo[5,4-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[6-chloro-3-[2-(trideuteriomethoxy)phenyl]pyrazolo[5,4-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 163251763 |
| Molecular Formula | C19H24ClN3O2Si |
| Molecular Weight | 392.98 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 2-[[6-chloro-3-[2-(trideuteriomethoxy)phenyl]pyrazolo[5,4-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | [2H]C([2H])([2H])Oc1ccccc1-c1nn(COCC[Si](C)(C)C)c2nc(Cl)ccc12 |
| InChI | InChI=1S/C19H24ClN3O2Si/c1-24-16-8-6-5-7-14(16)18-15-9-10-17(20)21-19(15)23(22-18)13-25-11-12-26(2,3)4/h5-10H,11-13H2,1-4H3/i1D3 |
| InChIKey | PTCRSZUMTHTBSB-FIBGUPNXSA-N |
| XLogP | 5.07 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.98 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|