C14H20N4OSi — CID 123634189
6-methyl-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-b]pyridine-3-carbonitrile (PubChem CID 123634189) has the molecular formula C14H20N4OSi and a molecular weight of 288.43 g/mol. Its IUPAC name is 6-methyl-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-b]pyridine-3-carbonitrile.
| Compound Name | 6-methyl-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-b]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 123634189 |
| Molecular Formula | C14H20N4OSi |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 6-methyl-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-b]pyridine-3-carbonitrile |
| SMILES | Cc1ccc2c(C#N)nn(COCC[Si](C)(C)C)c2n1 |
| InChI | InChI=1S/C14H20N4OSi/c1-11-5-6-12-13(9-15)17-18(14(12)16-11)10-19-7-8-20(2,3)4/h5-6H,7-8,10H2,1-4H3 |
| InChIKey | ITKPZCWTSULFKR-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 63.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|