C20H27N7O2Si — CID 123777860
7,7-dimethyl-3-[6-methyl-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-3-yl]-5H-pyrrolo[2,3-e][1,2,4]triazin-6-one (PubChem CID 123777860) has the molecular formula C20H27N7O2Si and a molecular weight of 425.57 g/mol. Its IUPAC name is 7,7-dimethyl-3-[6-methyl-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-3-yl]-5H-pyrrolo[2,3-e][1,2,4]triazin-6-one.
| Compound Name | 7,7-dimethyl-3-[6-methyl-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-3-yl]-5H-pyrrolo[2,3-e][1,2,4]triazin-6-one |
|---|---|
| PubChem CID | 123777860 |
| Molecular Formula | C20H27N7O2Si |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | 7,7-dimethyl-3-[6-methyl-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-3-yl]-5H-pyrrolo[2,3-e][1,2,4]triazin-6-one |
| SMILES | Cc1ccc2c(-c3nnc4c(n3)NC(=O)C4(C)C)nn(COCC[Si](C)(C)C)c2n1 |
| InChI | InChI=1S/C20H27N7O2Si/c1-12-7-8-13-14(16-22-17-15(24-25-16)20(2,3)19(28)23-17)26-27(18(13)21-12)11-29-9-10-30(4,5)6/h7-8H,9-11H2,1-6H3,(H,22,23,25,28) |
| InChIKey | YAAMXKXRNBJPJW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 107.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|