C24H38BrN5O2Si2 — CID 174065746
2-[[6-bromo-3-[3-(2-trimethylsilylethoxymethyl)-5,6-dihydro-4H-pyrrolo[3,4-d]imidazol-2-yl]indazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 174065746) has the molecular formula C24H38BrN5O2Si2 and a molecular weight of 564.68 g/mol. Its IUPAC name is 2-[[6-bromo-3-[3-(2-trimethylsilylethoxymethyl)-5,6-dihydro-4H-pyrrolo[3,4-d]imidazol-2-yl]indazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[6-bromo-3-[3-(2-trimethylsilylethoxymethyl)-5,6-dihydro-4H-pyrrolo[3,4-d]imidazol-2-yl]indazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 174065746 |
| Molecular Formula | C24H38BrN5O2Si2 |
| Molecular Weight | 564.68 g/mol |
| Exact Mass | 563.17 |
| IUPAC Name | 2-[[6-bromo-3-[3-(2-trimethylsilylethoxymethyl)-5,6-dihydro-4H-pyrrolo[3,4-d]imidazol-2-yl]indazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1c(-c2nn(COCC[Si](C)(C)C)c3cc(Br)ccc23)nc2c1CNC2 |
| InChI | InChI=1S/C24H38BrN5O2Si2/c1-33(2,3)11-9-31-16-29-22-15-26-14-20(22)27-24(29)23-19-8-7-18(25)13-21(19)30(28-23)17-32-10-12-34(4,5)6/h7-8,13,26H,9-12,14-17H2,1-6H3 |
| InChIKey | NUPXRPGEEJETNT-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 66.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.68 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|