C32H46BrN5O3Si2 — CID 69071584
2-[5-bromo-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]-5-ethyl-7,7-dimethyl-3-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-f]benzimidazol-6-one (PubChem CID 69071584) has the molecular formula C32H46BrN5O3Si2 and a molecular weight of 684.83 g/mol. Its IUPAC name is 2-[5-bromo-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]-5-ethyl-7,7-dimethyl-3-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-f]benzimidazol-6-one.
| Compound Name | 2-[5-bromo-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]-5-ethyl-7,7-dimethyl-3-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-f]benzimidazol-6-one |
|---|---|
| PubChem CID | 69071584 |
| Molecular Formula | C32H46BrN5O3Si2 |
| Molecular Weight | 684.83 g/mol |
| Exact Mass | 683.23 |
| IUPAC Name | 2-[5-bromo-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]-5-ethyl-7,7-dimethyl-3-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-f]benzimidazol-6-one |
| SMILES | CCN1C(=O)C(C)(C)c2cc3nc(-c4nn(COCC[Si](C)(C)C)c5ccc(Br)cc45)n(COCC[Si](C)(C)C)c3cc21 |
| InChI | InChI=1S/C32H46BrN5O3Si2/c1-10-36-27-19-28-25(18-24(27)32(2,3)31(36)39)34-30(37(28)20-40-13-15-42(4,5)6)29-23-17-22(33)11-12-26(23)38(35-29)21-41-14-16-43(7,8)9/h11-12,17-19H,10,13-16,20-21H2,1-9H3 |
| InChIKey | JRBDQQAVYYWNLC-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 74.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.83 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|