C27H42BrN5O2Si2 — CID 164532313
2-[[2-[(4aS,5aR)-5a-methyl-1-(2-trimethylsilylethoxymethyl)-4,4a,5,6-tetrahydrocyclopropa[f]indazol-3-yl]-6-bromoimidazo[4,5-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 164532313) has the molecular formula C27H42BrN5O2Si2 and a molecular weight of 604.74 g/mol. Its IUPAC name is 2-[[2-[(4aS,5aR)-5a-methyl-1-(2-trimethylsilylethoxymethyl)-4,4a,5,6-tetrahydrocyclopropa[f]indazol-3-yl]-6-bromoimidazo[4,5-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[2-[(4aS,5aR)-5a-methyl-1-(2-trimethylsilylethoxymethyl)-4,4a,5,6-tetrahydrocyclopropa[f]indazol-3-yl]-6-bromoimidazo[4,5-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 164532313 |
| Molecular Formula | C27H42BrN5O2Si2 |
| Molecular Weight | 604.74 g/mol |
| Exact Mass | 603.21 |
| IUPAC Name | 2-[[2-[(4aS,5aR)-5a-methyl-1-(2-trimethylsilylethoxymethyl)-4,4a,5,6-tetrahydrocyclopropa[f]indazol-3-yl]-6-bromoimidazo[4,5-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[C@@]12Cc3c(c(-c4nc5ncc(Br)cc5n4COCC[Si](C)(C)C)nn3COCC[Si](C)(C)C)C[C@@H]1C2 |
| InChI | InChI=1S/C27H42BrN5O2Si2/c1-27-14-19(27)12-21-23(15-27)33(18-35-9-11-37(5,6)7)31-24(21)26-30-25-22(13-20(28)16-29-25)32(26)17-34-8-10-36(2,3)4/h13,16,19H,8-12,14-15,17-18H2,1-7H3/t19-,27-/m1/s1 |
| InChIKey | IXDOMYCTHSVRAP-XHCCPWGMSA-N |
| XLogP | 6.81 |
| TPSA | 66.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.74 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|