C20H28BrN3OSi — CID 140874605
2-[[4-(5-bromo-1-ethylindol-3-yl)-3-methylpyrazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 140874605) has the molecular formula C20H28BrN3OSi and a molecular weight of 434.45 g/mol. Its IUPAC name is 2-[[4-(5-bromo-1-ethylindol-3-yl)-3-methylpyrazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[4-(5-bromo-1-ethylindol-3-yl)-3-methylpyrazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 140874605 |
| Molecular Formula | C20H28BrN3OSi |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | 2-[[4-(5-bromo-1-ethylindol-3-yl)-3-methylpyrazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | CCn1cc(-c2cn(COCC[Si](C)(C)C)nc2C)c2cc(Br)ccc21 |
| InChI | InChI=1S/C20H28BrN3OSi/c1-6-23-12-19(17-11-16(21)7-8-20(17)23)18-13-24(22-15(18)2)14-25-9-10-26(3,4)5/h7-8,11-13H,6,9-10,14H2,1-5H3 |
| InChIKey | FCYYGDUPNYGWOP-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 31.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|