C17H22BrN3OSi — CID 145066845
2-[[4-(5-bromo-1H-indol-3-yl)pyrazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 145066845) has the molecular formula C17H22BrN3OSi and a molecular weight of 392.37 g/mol. Its IUPAC name is 2-[[4-(5-bromo-1H-indol-3-yl)pyrazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[4-(5-bromo-1H-indol-3-yl)pyrazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 145066845 |
| Molecular Formula | C17H22BrN3OSi |
| Molecular Weight | 392.37 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | 2-[[4-(5-bromo-1H-indol-3-yl)pyrazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1cc(-c2c[nH]c3ccc(Br)cc23)cn1 |
| InChI | InChI=1S/C17H22BrN3OSi/c1-23(2,3)7-6-22-12-21-11-13(9-20-21)16-10-19-17-5-4-14(18)8-15(16)17/h4-5,8-11,19H,6-7,12H2,1-3H3 |
| InChIKey | YWFSFDAVZNJYOT-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 42.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.37 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|