C21H31BrN4OSi — CID 123479239
2-[[4-(5-bromo-1-pentan-3-ylpyrrolo[2,3-c]pyridin-3-yl)pyrazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 123479239) has the molecular formula C21H31BrN4OSi and a molecular weight of 463.50 g/mol. Its IUPAC name is 2-[[4-(5-bromo-1-pentan-3-ylpyrrolo[2,3-c]pyridin-3-yl)pyrazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[4-(5-bromo-1-pentan-3-ylpyrrolo[2,3-c]pyridin-3-yl)pyrazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 123479239 |
| Molecular Formula | C21H31BrN4OSi |
| Molecular Weight | 463.50 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | 2-[[4-(5-bromo-1-pentan-3-ylpyrrolo[2,3-c]pyridin-3-yl)pyrazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | CCC(CC)n1cc(-c2cnn(COCC[Si](C)(C)C)c2)c2cc(Br)ncc21 |
| InChI | InChI=1S/C21H31BrN4OSi/c1-6-17(7-2)26-14-19(18-10-21(22)23-12-20(18)26)16-11-24-25(13-16)15-27-8-9-28(3,4)5/h10-14,17H,6-9,15H2,1-5H3 |
| InChIKey | NKRUYBJDHRJFDO-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.50 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|