C16H20BrClN4OSi — CID 123539865
2-[[4-(5-bromo-1H-pyrrolo[2,3-c]pyridin-3-yl)-3-chloropyrazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 123539865) has the molecular formula C16H20BrClN4OSi and a molecular weight of 427.81 g/mol. Its IUPAC name is 2-[[4-(5-bromo-1H-pyrrolo[2,3-c]pyridin-3-yl)-3-chloropyrazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[4-(5-bromo-1H-pyrrolo[2,3-c]pyridin-3-yl)-3-chloropyrazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 123539865 |
| Molecular Formula | C16H20BrClN4OSi |
| Molecular Weight | 427.81 g/mol |
| Exact Mass | 426.03 |
| IUPAC Name | 2-[[4-(5-bromo-1H-pyrrolo[2,3-c]pyridin-3-yl)-3-chloropyrazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1cc(-c2c[nH]c3cnc(Br)cc23)c(Cl)n1 |
| InChI | InChI=1S/C16H20BrClN4OSi/c1-24(2,3)5-4-23-10-22-9-13(16(18)21-22)12-7-19-14-8-20-15(17)6-11(12)14/h6-9,19H,4-5,10H2,1-3H3 |
| InChIKey | HFGHXIYBHGNTHH-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.81 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|