C12H20Br2N4OSi — CID 161078247
5-bromo-1H-imidazole;2-[(4-bromoimidazol-1-yl)methoxy]ethyl-trimethylsilane (PubChem CID 161078247) has the molecular formula C12H20Br2N4OSi and a molecular weight of 424.21 g/mol. Its IUPAC name is 5-bromo-1H-imidazole;2-[(4-bromoimidazol-1-yl)methoxy]ethyl-trimethylsilane.
| Compound Name | 5-bromo-1H-imidazole;2-[(4-bromoimidazol-1-yl)methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 161078247 |
| Molecular Formula | C12H20Br2N4OSi |
| Molecular Weight | 424.21 g/mol |
| Exact Mass | 421.98 |
| IUPAC Name | 5-bromo-1H-imidazole;2-[(4-bromoimidazol-1-yl)methoxy]ethyl-trimethylsilane |
| SMILES | Brc1cnc[nH]1.C[Si](C)(C)CCOCn1cnc(Br)c1 |
| InChI | InChI=1S/C9H17BrN2OSi.C3H3BrN2/c1-14(2,3)5-4-13-8-12-6-9(10)11-7-12;4-3-1-5-2-6-3/h6-7H,4-5,8H2,1-3H3;1-2H,(H,5,6) |
| InChIKey | UFOKOAUYYNEDGG-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.21 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|