C14H25N3O2Si — CID 10469798
(4S,5R)-5-methyl-4-[1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]pyrrolidin-2-one (PubChem CID 10469798) has the molecular formula C14H25N3O2Si and a molecular weight of 295.46 g/mol. Its IUPAC name is (4S,5R)-5-methyl-4-[1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]pyrrolidin-2-one.
| Compound Name | (4S,5R)-5-methyl-4-[1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 10469798 |
| Molecular Formula | C14H25N3O2Si |
| Molecular Weight | 295.46 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | (4S,5R)-5-methyl-4-[1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]pyrrolidin-2-one |
| SMILES | C[C@H]1NC(=O)C[C@@H]1c1cn(COCC[Si](C)(C)C)cn1 |
| InChI | InChI=1S/C14H25N3O2Si/c1-11-12(7-14(18)16-11)13-8-17(9-15-13)10-19-5-6-20(2,3)4/h8-9,11-12H,5-7,10H2,1-4H3,(H,16,18)/t11-,12+/m1/s1 |
| InChIKey | FVOKQINDYOJGDR-NEPJUHHUSA-N |
| XLogP | 2.19 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.46 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|