C16H22BrClN2O2Si — CID 169030760
2-[[4-(2-bromo-4-chloro-5-methoxyphenyl)imidazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 169030760) has the molecular formula C16H22BrClN2O2Si and a molecular weight of 417.81 g/mol. Its IUPAC name is 2-[[4-(2-bromo-4-chloro-5-methoxyphenyl)imidazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[4-(2-bromo-4-chloro-5-methoxyphenyl)imidazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 169030760 |
| Molecular Formula | C16H22BrClN2O2Si |
| Molecular Weight | 417.81 g/mol |
| Exact Mass | 416.03 |
| IUPAC Name | 2-[[4-(2-bromo-4-chloro-5-methoxyphenyl)imidazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | COc1cc(-c2cn(COCC[Si](C)(C)C)cn2)c(Br)cc1Cl |
| InChI | InChI=1S/C16H22BrClN2O2Si/c1-21-16-7-12(13(17)8-14(16)18)15-9-20(10-19-15)11-22-5-6-23(2,3)4/h7-10H,5-6,11H2,1-4H3 |
| InChIKey | HOZGFJJFHKWOCD-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.81 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|