C16H23N3O2Si — CID 131736066
7-cyclopropyl-3-(2-trimethylsilylethoxymethyl)pyrido[4,3-d]pyrimidin-4-one (PubChem CID 131736066) has the molecular formula C16H23N3O2Si and a molecular weight of 317.47 g/mol. Its IUPAC name is 7-cyclopropyl-3-(2-trimethylsilylethoxymethyl)pyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 7-cyclopropyl-3-(2-trimethylsilylethoxymethyl)pyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 131736066 |
| Molecular Formula | C16H23N3O2Si |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 7-cyclopropyl-3-(2-trimethylsilylethoxymethyl)pyrido[4,3-d]pyrimidin-4-one |
| SMILES | C[Si](C)(C)CCOCn1cnc2cc(C3CC3)ncc2c1=O |
| InChI | InChI=1S/C16H23N3O2Si/c1-22(2,3)7-6-21-11-19-10-18-15-8-14(12-4-5-12)17-9-13(15)16(19)20/h8-10,12H,4-7,11H2,1-3H3 |
| InChIKey | MWCJRMYPSSFPMR-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|