C31H41BrN4OSi2 — CID 11802011
2-[[2-(6-bromo-1H-indol-3-yl)-5-[1-[tert-butyl(dimethyl)silyl]indol-3-yl]imidazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 11802011) has the molecular formula C31H41BrN4OSi2 and a molecular weight of 621.77 g/mol. Its IUPAC name is 2-[[2-(6-bromo-1H-indol-3-yl)-5-[1-[tert-butyl(dimethyl)silyl]indol-3-yl]imidazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[2-(6-bromo-1H-indol-3-yl)-5-[1-[tert-butyl(dimethyl)silyl]indol-3-yl]imidazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 11802011 |
| Molecular Formula | C31H41BrN4OSi2 |
| Molecular Weight | 621.77 g/mol |
| Exact Mass | 620.20 |
| IUPAC Name | 2-[[2-(6-bromo-1H-indol-3-yl)-5-[1-[tert-butyl(dimethyl)silyl]indol-3-yl]imidazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)n1cc(-c2cnc(-c3c[nH]c4cc(Br)ccc34)n2COCC[Si](C)(C)C)c2ccccc21 |
| InChI | InChI=1S/C31H41BrN4OSi2/c1-31(2,3)39(7,8)36-20-26(24-11-9-10-12-28(24)36)29-19-34-30(35(29)21-37-15-16-38(4,5)6)25-18-33-27-17-22(32)13-14-23(25)27/h9-14,17-20,33H,15-16,21H2,1-8H3 |
| InChIKey | XKFBOWWIROCNDW-UHFFFAOYSA-N |
| XLogP | 9.58 |
| TPSA | 47.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.77 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|