C22H14Br2N2O3 — CID 174816686
3-(6-bromo-1-ethylindol-3-yl)-4-(6-bromo-1H-indol-3-yl)furan-2,5-dione (PubChem CID 174816686) has the molecular formula C22H14Br2N2O3 and a molecular weight of 514.17 g/mol. Its IUPAC name is 3-(6-bromo-1-ethylindol-3-yl)-4-(6-bromo-1H-indol-3-yl)furan-2,5-dione.
| Compound Name | 3-(6-bromo-1-ethylindol-3-yl)-4-(6-bromo-1H-indol-3-yl)furan-2,5-dione |
|---|---|
| PubChem CID | 174816686 |
| Molecular Formula | C22H14Br2N2O3 |
| Molecular Weight | 514.17 g/mol |
| Exact Mass | 511.94 |
| IUPAC Name | 3-(6-bromo-1-ethylindol-3-yl)-4-(6-bromo-1H-indol-3-yl)furan-2,5-dione |
| SMILES | CCn1cc(C2=C(c3c[nH]c4cc(Br)ccc34)C(=O)OC2=O)c2ccc(Br)cc21 |
| InChI | InChI=1S/C22H14Br2N2O3/c1-2-26-10-16(14-6-4-12(24)8-18(14)26)20-19(21(27)29-22(20)28)15-9-25-17-7-11(23)3-5-13(15)17/h3-10,25H,2H2,1H3 |
| InChIKey | WEQKJWHPKZFVML-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.17 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|