C25H21N3O2 — CID 137393254
3-(1-ethylindol-3-yl)-4-(6-prop-2-enyl-1H-indol-3-yl)pyrrole-2,5-dione (PubChem CID 137393254) has the molecular formula C25H21N3O2 and a molecular weight of 395.46 g/mol. Its IUPAC name is 3-(1-ethylindol-3-yl)-4-(6-prop-2-enyl-1H-indol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-(1-ethylindol-3-yl)-4-(6-prop-2-enyl-1H-indol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 137393254 |
| Molecular Formula | C25H21N3O2 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 3-(1-ethylindol-3-yl)-4-(6-prop-2-enyl-1H-indol-3-yl)pyrrole-2,5-dione |
| SMILES | C=CCc1ccc2c(C3=C(c4cn(CC)c5ccccc45)C(=O)NC3=O)c[nH]c2c1 |
| InChI | InChI=1S/C25H21N3O2/c1-3-7-15-10-11-16-18(13-26-20(16)12-15)22-23(25(30)27-24(22)29)19-14-28(4-2)21-9-6-5-8-17(19)21/h3,5-6,8-14,26H,1,4,7H2,2H3,(H,27,29,30) |
| InChIKey | OUSIRBOGXPUXHN-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|