C23H17Cl2N3O2 — CID 137393227
3-(6-chloro-1-ethylindol-3-yl)-4-(6-chloro-1H-indol-3-yl)-1-methylpyrrole-2,5-dione (PubChem CID 137393227) has the molecular formula C23H17Cl2N3O2 and a molecular weight of 438.31 g/mol. Its IUPAC name is 3-(6-chloro-1-ethylindol-3-yl)-4-(6-chloro-1H-indol-3-yl)-1-methylpyrrole-2,5-dione.
| Compound Name | 3-(6-chloro-1-ethylindol-3-yl)-4-(6-chloro-1H-indol-3-yl)-1-methylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 137393227 |
| Molecular Formula | C23H17Cl2N3O2 |
| Molecular Weight | 438.31 g/mol |
| Exact Mass | 437.07 |
| IUPAC Name | 3-(6-chloro-1-ethylindol-3-yl)-4-(6-chloro-1H-indol-3-yl)-1-methylpyrrole-2,5-dione |
| SMILES | CCn1cc(C2=C(c3c[nH]c4cc(Cl)ccc34)C(=O)N(C)C2=O)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C23H17Cl2N3O2/c1-3-28-11-17(15-7-5-13(25)9-19(15)28)21-20(22(29)27(2)23(21)30)16-10-26-18-8-12(24)4-6-14(16)18/h4-11,26H,3H2,1-2H3 |
| InChIKey | KAPHDSMFPAJVSY-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 58.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.31 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|