C23H18ClN3O3 — CID 175183271
3-(6-chloro-1H-indol-3-yl)-4-(1-ethylindol-3-yl)-1-(hydroxymethyl)pyrrole-2,5-dione (PubChem CID 175183271) has the molecular formula C23H18ClN3O3 and a molecular weight of 419.87 g/mol. Its IUPAC name is 3-(6-chloro-1H-indol-3-yl)-4-(1-ethylindol-3-yl)-1-(hydroxymethyl)pyrrole-2,5-dione.
| Compound Name | 3-(6-chloro-1H-indol-3-yl)-4-(1-ethylindol-3-yl)-1-(hydroxymethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 175183271 |
| Molecular Formula | C23H18ClN3O3 |
| Molecular Weight | 419.87 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | 3-(6-chloro-1H-indol-3-yl)-4-(1-ethylindol-3-yl)-1-(hydroxymethyl)pyrrole-2,5-dione |
| SMILES | CCn1cc(C2=C(c3c[nH]c4cc(Cl)ccc34)C(=O)N(CO)C2=O)c2ccccc21 |
| InChI | InChI=1S/C23H18ClN3O3/c1-2-26-11-17(15-5-3-4-6-19(15)26)21-20(22(29)27(12-28)23(21)30)16-10-25-18-9-13(24)7-8-14(16)18/h3-11,25,28H,2,12H2,1H3 |
| InChIKey | KBXNSBLRRBPLEU-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 78.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.87 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|