C24H20FN3O4 — CID 175183808
3-(1-ethylindol-3-yl)-4-[6-fluoro-1-(hydroxymethyl)indol-3-yl]-1-(hydroxymethyl)pyrrole-2,5-dione (PubChem CID 175183808) has the molecular formula C24H20FN3O4 and a molecular weight of 433.44 g/mol. Its IUPAC name is 3-(1-ethylindol-3-yl)-4-[6-fluoro-1-(hydroxymethyl)indol-3-yl]-1-(hydroxymethyl)pyrrole-2,5-dione.
| Compound Name | 3-(1-ethylindol-3-yl)-4-[6-fluoro-1-(hydroxymethyl)indol-3-yl]-1-(hydroxymethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 175183808 |
| Molecular Formula | C24H20FN3O4 |
| Molecular Weight | 433.44 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | 3-(1-ethylindol-3-yl)-4-[6-fluoro-1-(hydroxymethyl)indol-3-yl]-1-(hydroxymethyl)pyrrole-2,5-dione |
| SMILES | CCn1cc(C2=C(c3cn(CO)c4cc(F)ccc34)C(=O)N(CO)C2=O)c2ccccc21 |
| InChI | InChI=1S/C24H20FN3O4/c1-2-26-10-17(15-5-3-4-6-19(15)26)21-22(24(32)28(13-30)23(21)31)18-11-27(12-29)20-9-14(25)7-8-16(18)20/h3-11,29-30H,2,12-13H2,1H3 |
| InChIKey | QVVAPQZRGQDGDC-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 87.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.44 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|