C29H21BrN2O3 — CID 174816640
3-(1-benzyl-4-bromoindol-3-yl)-4-(1-ethylindol-3-yl)furan-2,5-dione (PubChem CID 174816640) has the molecular formula C29H21BrN2O3 and a molecular weight of 525.40 g/mol. Its IUPAC name is 3-(1-benzyl-4-bromoindol-3-yl)-4-(1-ethylindol-3-yl)furan-2,5-dione.
| Compound Name | 3-(1-benzyl-4-bromoindol-3-yl)-4-(1-ethylindol-3-yl)furan-2,5-dione |
|---|---|
| PubChem CID | 174816640 |
| Molecular Formula | C29H21BrN2O3 |
| Molecular Weight | 525.40 g/mol |
| Exact Mass | 524.07 |
| IUPAC Name | 3-(1-benzyl-4-bromoindol-3-yl)-4-(1-ethylindol-3-yl)furan-2,5-dione |
| SMILES | CCn1cc(C2=C(c3cn(Cc4ccccc4)c4cccc(Br)c34)C(=O)OC2=O)c2ccccc21 |
| InChI | InChI=1S/C29H21BrN2O3/c1-2-31-16-20(19-11-6-7-13-23(19)31)26-27(29(34)35-28(26)33)21-17-32(15-18-9-4-3-5-10-18)24-14-8-12-22(30)25(21)24/h3-14,16-17H,2,15H2,1H3 |
| InChIKey | WCBGTBMKYXZXAI-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 53.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.40 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|