About 1-benzyl-3-methylindole;ethane
1-benzyl-3-methylindole;ethane (PubChem CID 145343697) has the molecular formula C18H21N
and a molecular weight of 251.37 g/mol. Its IUPAC name is 1-benzyl-3-methylindole;ethane.
Molecular Properties
| Compound Name | 1-benzyl-3-methylindole;ethane |
| PubChem CID | 145343697 |
| Molecular Formula | C18H21N |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | 1-benzyl-3-methylindole;ethane |
| SMILES | CC.Cc1cn(Cc2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C16H15N.C2H6/c1-13-11-17(12-14-7-3-2-4-8-14)16-10-6-5-9-15(13)16;1-2/h2-11H,12H2,1H3;1-2H3 |
| InChIKey | UHGNKWAIVCTWEU-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-benzyl-3-methylindole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-3-methylindole;ethane?
The IUPAC name of 1-benzyl-3-methylindole;ethane (CID 145343697) is 1-benzyl-3-methylindole;ethane.
What is the SMILES notation for 1-benzyl-3-methylindole;ethane?
The canonical SMILES for 1-benzyl-3-methylindole;ethane is CC.Cc1cn(Cc2ccccc2)c2ccccc12.
What is the InChIKey of 1-benzyl-3-methylindole;ethane?
The InChIKey is UHGNKWAIVCTWEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N.C2H6/c1-13-11-17(12-14-7-3-2-4-8-14)16-10-6-5-9-15(13)16;1-2/h2-11H,12H2,1H3;1-2H3.
What are the key properties of 1-benzyl-3-methylindole;ethane?
1-benzyl-3-methylindole;ethane has a molecular weight of 251.37 g/mol, XLogP of 5.02, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-3-methylindole;ethane is sourced from PubChem (CID 145343697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).