C19H21NO2 — CID 23496284
1-benzyl-3-methylindole;1,3-dioxolane (PubChem CID 23496284) has the molecular formula C19H21NO2 and a molecular weight of 295.38 g/mol. Its IUPAC name is 1-benzyl-3-methylindole;1,3-dioxolane.
| Compound Name | 1-benzyl-3-methylindole;1,3-dioxolane |
|---|---|
| PubChem CID | 23496284 |
| Molecular Formula | C19H21NO2 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 1-benzyl-3-methylindole;1,3-dioxolane |
| SMILES | C1COCO1.Cc1cn(Cc2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C16H15N.C3H6O2/c1-13-11-17(12-14-7-3-2-4-8-14)16-10-6-5-9-15(13)16;1-2-5-3-4-1/h2-11H,12H2,1H3;1-3H2 |
| InChIKey | HLWMOSBEUPFSBJ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |