C29H22BrN3O2 — CID 147694840
3-(1-benzyl-4-bromoindol-3-yl)-4-(1-ethylindol-3-yl)pyrrole-2,5-dione (PubChem CID 147694840) has the molecular formula C29H22BrN3O2 and a molecular weight of 524.42 g/mol. Its IUPAC name is 3-(1-benzyl-4-bromoindol-3-yl)-4-(1-ethylindol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-(1-benzyl-4-bromoindol-3-yl)-4-(1-ethylindol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 147694840 |
| Molecular Formula | C29H22BrN3O2 |
| Molecular Weight | 524.42 g/mol |
| Exact Mass | 523.09 |
| IUPAC Name | 3-(1-benzyl-4-bromoindol-3-yl)-4-(1-ethylindol-3-yl)pyrrole-2,5-dione |
| SMILES | CCn1cc(C2=C(c3cn(Cc4ccccc4)c4cccc(Br)c34)C(=O)NC2=O)c2ccccc21 |
| InChI | InChI=1S/C29H22BrN3O2/c1-2-32-16-20(19-11-6-7-13-23(19)32)26-27(29(35)31-28(26)34)21-17-33(15-18-9-4-3-5-10-18)24-14-8-12-22(30)25(21)24/h3-14,16-17H,2,15H2,1H3,(H,31,34,35) |
| InChIKey | GRRQWDYJRFMPBG-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 56.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.42 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|